C14H22N2O6S — CID 119350785
7-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]amino]heptanoic acid (PubChem CID 119350785) has the molecular formula C14H22N2O6S and a molecular weight of 346.41 g/mol. Its IUPAC name is 7-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]amino]heptanoic acid.
| Compound Name | 7-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 119350785 |
| Molecular Formula | C14H22N2O6S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 7-[[2-methyl-5-(methylsulfamoyl)furan-3-carbonyl]amino]heptanoic acid |
| SMILES | CNS(=O)(=O)c1cc(C(=O)NCCCCCCC(=O)O)c(C)o1 |
| InChI | InChI=1S/C14H22N2O6S/c1-10-11(9-13(22-10)23(20,21)15-2)14(19)16-8-6-4-3-5-7-12(17)18/h9,15H,3-8H2,1-2H3,(H,16,19)(H,17,18) |
| InChIKey | NUOSORPVNQWRPQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 125.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|