C12H21N3O4S — CID 119434335
5-(dimethylsulfamoyl)-2-methyl-N-[3-(methylamino)propyl]furan-3-carboxamide (PubChem CID 119434335) has the molecular formula C12H21N3O4S and a molecular weight of 303.38 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-methyl-N-[3-(methylamino)propyl]furan-3-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-2-methyl-N-[3-(methylamino)propyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 119434335 |
| Molecular Formula | C12H21N3O4S |
| Molecular Weight | 303.38 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-methyl-N-[3-(methylamino)propyl]furan-3-carboxamide |
| SMILES | CNCCCNC(=O)c1cc(S(=O)(=O)N(C)C)oc1C |
| InChI | InChI=1S/C12H21N3O4S/c1-9-10(12(16)14-7-5-6-13-2)8-11(19-9)20(17,18)15(3)4/h8,13H,5-7H2,1-4H3,(H,14,16) |
| InChIKey | NJGHRBQYKKWVJY-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.38 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|