C8H11NO5S — CID 2736868
5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid (PubChem CID 2736868) has the molecular formula C8H11NO5S and a molecular weight of 233.24 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid.
| Compound Name | 5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid |
|---|---|
| PubChem CID | 2736868 |
| Molecular Formula | C8H11NO5S |
| Molecular Weight | 233.24 g/mol |
| Exact Mass | 233.04 |
| IUPAC Name | 5-(dimethylsulfamoyl)-2-methylfuran-3-carboxylic acid |
| SMILES | Cc1oc(S(=O)(=O)N(C)C)cc1C(=O)O |
| InChI | InChI=1S/C8H11NO5S/c1-5-6(8(10)11)4-7(14-5)15(12,13)9(2)3/h4H,1-3H3,(H,10,11) |
| InChIKey | DUFCMRCMPHIFTR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 87.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |