C15H22N2O6S — CID 122113960
1-[5-(dimethylsulfamoyl)-2-methylfuran-3-carbonyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122113960) has the molecular formula C15H22N2O6S and a molecular weight of 358.42 g/mol. Its IUPAC name is 1-[5-(dimethylsulfamoyl)-2-methylfuran-3-carbonyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[5-(dimethylsulfamoyl)-2-methylfuran-3-carbonyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122113960 |
| Molecular Formula | C15H22N2O6S |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | 1-[5-(dimethylsulfamoyl)-2-methylfuran-3-carbonyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | Cc1oc(S(=O)(=O)N(C)C)cc1C(=O)N1CC(C(=O)O)CCC1C |
| InChI | InChI=1S/C15H22N2O6S/c1-9-5-6-11(15(19)20)8-17(9)14(18)12-7-13(23-10(12)2)24(21,22)16(3)4/h7,9,11H,5-6,8H2,1-4H3,(H,19,20) |
| InChIKey | UJLRKOWJHXDOJC-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 108.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |