C13H15N3O5S — CID 75377792
5-(dimethylsulfamoyl)-N-(3-hydroxy-4-pyridinyl)-2-methylfuran-3-carboxamide (PubChem CID 75377792) has the molecular formula C13H15N3O5S and a molecular weight of 325.35 g/mol. Its IUPAC name is 5-(dimethylsulfamoyl)-N-(3-hydroxy-4-pyridinyl)-2-methylfuran-3-carboxamide.
| Compound Name | 5-(dimethylsulfamoyl)-N-(3-hydroxy-4-pyridinyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 75377792 |
| Molecular Formula | C13H15N3O5S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.07 |
| IUPAC Name | 5-(dimethylsulfamoyl)-N-(3-hydroxy-4-pyridinyl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1oc(S(=O)(=O)N(C)C)cc1C(=O)Nc1ccncc1O |
| InChI | InChI=1S/C13H15N3O5S/c1-8-9(6-12(21-8)22(19,20)16(2)3)13(18)15-10-4-5-14-7-11(10)17/h4-7,17H,1-3H3,(H,14,15,18) |
| InChIKey | WKVDJJPCGOOWQA-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |