C12H9FN2O3 — CID 75447606
2-fluoro-4-hydroxy-N-(3-hydroxy-4-pyridinyl)benzamide (PubChem CID 75447606) has the molecular formula C12H9FN2O3 and a molecular weight of 248.21 g/mol. Its IUPAC name is 2-fluoro-4-hydroxy-N-(3-hydroxy-4-pyridinyl)benzamide.
| Compound Name | 2-fluoro-4-hydroxy-N-(3-hydroxy-4-pyridinyl)benzamide |
|---|---|
| PubChem CID | 75447606 |
| Molecular Formula | C12H9FN2O3 |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 2-fluoro-4-hydroxy-N-(3-hydroxy-4-pyridinyl)benzamide |
| SMILES | O=C(Nc1ccncc1O)c1ccc(O)cc1F |
| InChI | InChI=1S/C12H9FN2O3/c13-9-5-7(16)1-2-8(9)12(18)15-10-3-4-14-6-11(10)17/h1-6,16-17H,(H,14,15,18) |
| InChIKey | OZHJBKJBABNSAY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |