C8H11NO3 — CID 60716938
N-methoxy-2,5-dimethylfuran-3-carboxamide (PubChem CID 60716938) has the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. Its IUPAC name is N-methoxy-2,5-dimethylfuran-3-carboxamide.
| Compound Name | N-methoxy-2,5-dimethylfuran-3-carboxamide |
|---|---|
| PubChem CID | 60716938 |
| Molecular Formula | C8H11NO3 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | N-methoxy-2,5-dimethylfuran-3-carboxamide |
| SMILES | CONC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C8H11NO3/c1-5-4-7(6(2)12-5)8(10)9-11-3/h4H,1-3H3,(H,9,10) |
| InChIKey | KOCNVDMXAMNDCJ-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|