C10H14N2O4 — CID 47102396
N'-(2-methoxyacetyl)-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 47102396) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is N'-(2-methoxyacetyl)-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-(2-methoxyacetyl)-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 47102396 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | N'-(2-methoxyacetyl)-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | COCC(=O)NNC(=O)c1cc(C)oc1C |
| InChI | InChI=1S/C10H14N2O4/c1-6-4-8(7(2)16-6)10(14)12-11-9(13)5-15-3/h4H,5H2,1-3H3,(H,11,13)(H,12,14) |
| InChIKey | JNCOORPXLFVALS-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|