C19H24N2O5S — CID 9427814
N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,5-dimethylfuran-3-carbohydrazide (PubChem CID 9427814) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,5-dimethylfuran-3-carbohydrazide.
| Compound Name | N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,5-dimethylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9427814 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,5-dimethylfuran-3-carbohydrazide |
| SMILES | COc1cc(C)c(CSCC(=O)NNC(=O)c2cc(C)oc2C)cc1OC |
| InChI | InChI=1S/C19H24N2O5S/c1-11-6-16(24-4)17(25-5)8-14(11)9-27-10-18(22)20-21-19(23)15-7-12(2)26-13(15)3/h6-8H,9-10H2,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | ZCMFHXHIRWLTHX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|