C21H26N2O4S — CID 9276938
N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,4-dimethylbenzohydrazide (PubChem CID 9276938) has the molecular formula C21H26N2O4S and a molecular weight of 402.52 g/mol. Its IUPAC name is N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,4-dimethylbenzohydrazide.
| Compound Name | N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,4-dimethylbenzohydrazide |
|---|---|
| PubChem CID | 9276938 |
| Molecular Formula | C21H26N2O4S |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-2,4-dimethylbenzohydrazide |
| SMILES | COc1cc(C)c(CSCC(=O)NNC(=O)c2ccc(C)cc2C)cc1OC |
| InChI | InChI=1S/C21H26N2O4S/c1-13-6-7-17(15(3)8-13)21(25)23-22-20(24)12-28-11-16-10-19(27-5)18(26-4)9-14(16)2/h6-10H,11-12H2,1-5H3,(H,22,24)(H,23,25) |
| InChIKey | GQAJKTMATIPFIY-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|