C19H21N3O6S — CID 9401570
N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-4-nitrobenzohydrazide (PubChem CID 9401570) has the molecular formula C19H21N3O6S and a molecular weight of 419.46 g/mol. Its IUPAC name is N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9401570 |
| Molecular Formula | C19H21N3O6S |
| Molecular Weight | 419.46 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | N'-[2-[(4,5-dimethoxy-2-methylphenyl)methylsulfanyl]acetyl]-4-nitrobenzohydrazide |
| SMILES | COc1cc(C)c(CSCC(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)cc1OC |
| InChI | InChI=1S/C19H21N3O6S/c1-12-8-16(27-2)17(28-3)9-14(12)10-29-11-18(23)20-21-19(24)13-4-6-15(7-5-13)22(25)26/h4-9H,10-11H2,1-3H3,(H,20,23)(H,21,24) |
| InChIKey | SBDLMHRDEBRXID-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|