C17H17N3O6 — CID 9401565
N'-[2-(2,4-dimethoxyphenyl)acetyl]-4-nitrobenzohydrazide (PubChem CID 9401565) has the molecular formula C17H17N3O6 and a molecular weight of 359.34 g/mol. Its IUPAC name is N'-[2-(2,4-dimethoxyphenyl)acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-(2,4-dimethoxyphenyl)acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 9401565 |
| Molecular Formula | C17H17N3O6 |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | N'-[2-(2,4-dimethoxyphenyl)acetyl]-4-nitrobenzohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C17H17N3O6/c1-25-14-8-5-12(15(10-14)26-2)9-16(21)18-19-17(22)11-3-6-13(7-4-11)20(23)24/h3-8,10H,9H2,1-2H3,(H,18,21)(H,19,22) |
| InChIKey | ANXWVGLPYUSHFR-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 119.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|