C17H15N3O7 — CID 7702979
[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-methoxybenzoate (PubChem CID 7702979) has the molecular formula C17H15N3O7 and a molecular weight of 373.32 g/mol. Its IUPAC name is [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-methoxybenzoate.
| Compound Name | [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-methoxybenzoate |
|---|---|
| PubChem CID | 7702979 |
| Molecular Formula | C17H15N3O7 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 373.09 |
| IUPAC Name | [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 3-methoxybenzoate |
| SMILES | COc1cccc(C(=O)OCC(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)c1 |
| InChI | InChI=1S/C17H15N3O7/c1-26-14-4-2-3-12(9-14)17(23)27-10-15(21)18-19-16(22)11-5-7-13(8-6-11)20(24)25/h2-9H,10H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | IQQARNHTMPWOPU-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|