C15H13N3O7 — CID 7663405
[2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate (PubChem CID 7663405) has the molecular formula C15H13N3O7 and a molecular weight of 347.28 g/mol. Its IUPAC name is [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate.
| Compound Name | [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7663405 |
| Molecular Formula | C15H13N3O7 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | [2-[2-(4-nitrobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)OCC(=O)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H13N3O7/c1-9-12(6-7-24-9)15(21)25-8-13(19)16-17-14(20)10-2-4-11(5-3-10)18(22)23/h2-7H,8H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | NPKWWTWKUZQLIR-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 140.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|