C20H18N4O6 — CID 1011836
1-N',4-N'-bis(2-methylfuran-3-carbonyl)benzene-1,4-dicarbohydrazide (PubChem CID 1011836) has the molecular formula C20H18N4O6 and a molecular weight of 410.39 g/mol. Its IUPAC name is 1-N',4-N'-bis(2-methylfuran-3-carbonyl)benzene-1,4-dicarbohydrazide.
| Compound Name | 1-N',4-N'-bis(2-methylfuran-3-carbonyl)benzene-1,4-dicarbohydrazide |
|---|---|
| PubChem CID | 1011836 |
| Molecular Formula | C20H18N4O6 |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.12 |
| IUPAC Name | 1-N',4-N'-bis(2-methylfuran-3-carbonyl)benzene-1,4-dicarbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1ccc(C(=O)NNC(=O)c2ccoc2C)cc1 |
| InChI | InChI=1S/C20H18N4O6/c1-11-15(7-9-29-11)19(27)23-21-17(25)13-3-5-14(6-4-13)18(26)22-24-20(28)16-8-10-30-12(16)2/h3-10H,1-2H3,(H,21,25)(H,22,26)(H,23,27)(H,24,28) |
| InChIKey | IPVNMFYWVSPDFW-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 142.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|