C15H13ClN2O5 — CID 7663401
[2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate (PubChem CID 7663401) has the molecular formula C15H13ClN2O5 and a molecular weight of 336.73 g/mol. Its IUPAC name is [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate.
| Compound Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate |
|---|---|
| PubChem CID | 7663401 |
| Molecular Formula | C15H13ClN2O5 |
| Molecular Weight | 336.73 g/mol |
| Exact Mass | 336.05 |
| IUPAC Name | [2-[2-(4-chlorobenzoyl)hydrazinyl]-2-oxoethyl] 2-methylfuran-3-carboxylate |
| SMILES | Cc1occc1C(=O)OCC(=O)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H13ClN2O5/c1-9-12(6-7-22-9)15(21)23-8-13(19)17-18-14(20)10-2-4-11(16)5-3-10/h2-7H,8H2,1H3,(H,17,19)(H,18,20) |
| InChIKey | BLBJVFGMXUOOEP-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|