C11H9ClN2O4 — CID 30137081
N'-(5-chlorofuran-2-carbonyl)-2-methylfuran-3-carbohydrazide (PubChem CID 30137081) has the molecular formula C11H9ClN2O4 and a molecular weight of 268.66 g/mol. Its IUPAC name is N'-(5-chlorofuran-2-carbonyl)-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-(5-chlorofuran-2-carbonyl)-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 30137081 |
| Molecular Formula | C11H9ClN2O4 |
| Molecular Weight | 268.66 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | N'-(5-chlorofuran-2-carbonyl)-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1ccc(Cl)o1 |
| InChI | InChI=1S/C11H9ClN2O4/c1-6-7(4-5-17-6)10(15)13-14-11(16)8-2-3-9(12)18-8/h2-5H,1H3,(H,13,15)(H,14,16) |
| InChIKey | SWBLXHPQRHXJBN-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.66 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|