C12H10NO5- — CID 5059082
5-[[(2-methylfuran-3-carbonyl)amino]methyl]furan-2-carboxylate (PubChem CID 5059082) has the molecular formula C12H10NO5- and a molecular weight of 248.21 g/mol. Its IUPAC name is 5-[[(2-methylfuran-3-carbonyl)amino]methyl]furan-2-carboxylate.
| Compound Name | 5-[[(2-methylfuran-3-carbonyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 5059082 |
| Molecular Formula | C12H10NO5- |
| Molecular Weight | 248.21 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 5-[[(2-methylfuran-3-carbonyl)amino]methyl]furan-2-carboxylate |
| SMILES | Cc1occc1C(=O)NCc1ccc(C(=O)[O-])o1 |
| InChI | InChI=1S/C12H11NO5/c1-7-9(4-5-17-7)11(14)13-6-8-2-3-10(18-8)12(15)16/h2-5H,6H2,1H3,(H,13,14)(H,15,16)/p-1 |
| InChIKey | YOBRTNVYCBTSBS-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 95.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.21 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |