C15H15N5O6 — CID 163124481
N-hydroxy-1-[[5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]furan-2-yl]methyl]pyrazol-4-amine oxide (PubChem CID 163124481) has the molecular formula C15H15N5O6 and a molecular weight of 361.31 g/mol. Its IUPAC name is N-hydroxy-1-[[5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]furan-2-yl]methyl]pyrazol-4-amine oxide.
| Compound Name | N-hydroxy-1-[[5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]furan-2-yl]methyl]pyrazol-4-amine oxide |
|---|---|
| PubChem CID | 163124481 |
| Molecular Formula | C15H15N5O6 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | N-hydroxy-1-[[5-[[(2-methylfuran-3-carbonyl)amino]carbamoyl]furan-2-yl]methyl]pyrazol-4-amine oxide |
| SMILES | Cc1occc1C(=O)NNC(=O)c1ccc(Cn2cc([NH+]([O-])O)cn2)o1 |
| InChI | InChI=1S/C15H15N5O6/c1-9-12(4-5-25-9)14(21)17-18-15(22)13-3-2-11(26-13)8-19-7-10(6-16-19)20(23)24/h2-7,20,23H,8H2,1H3,(H,17,21)(H,18,22) |
| InChIKey | CTIAPXBFNFPFFK-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 150.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|