C16H15N3O4S — CID 71978749
N-(1-benzylpyrazol-4-yl)sulfonyl-2-methylfuran-3-carboxamide (PubChem CID 71978749) has the molecular formula C16H15N3O4S and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(1-benzylpyrazol-4-yl)sulfonyl-2-methylfuran-3-carboxamide.
| Compound Name | N-(1-benzylpyrazol-4-yl)sulfonyl-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 71978749 |
| Molecular Formula | C16H15N3O4S |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(1-benzylpyrazol-4-yl)sulfonyl-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NS(=O)(=O)c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C16H15N3O4S/c1-12-15(7-8-23-12)16(20)18-24(21,22)14-9-17-19(11-14)10-13-5-3-2-4-6-13/h2-9,11H,10H2,1H3,(H,18,20) |
| InChIKey | QJDMWZLCXDCFFD-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |