C12H11NO4S — CID 47231856
N-(benzenesulfonyl)-2-methylfuran-3-carboxamide (PubChem CID 47231856) has the molecular formula C12H11NO4S and a molecular weight of 265.29 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-methylfuran-3-carboxamide.
| Compound Name | N-(benzenesulfonyl)-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 47231856 |
| Molecular Formula | C12H11NO4S |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.04 |
| IUPAC Name | N-(benzenesulfonyl)-2-methylfuran-3-carboxamide |
| SMILES | Cc1occc1C(=O)NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H11NO4S/c1-9-11(7-8-17-9)12(14)13-18(15,16)10-5-3-2-4-6-10/h2-8H,1H3,(H,13,14) |
| InChIKey | HMFFHYPZFNZEHU-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |