C15H16N2O5S — CID 9472671
N'-[3-(benzenesulfonyl)propanoyl]-2-methylfuran-3-carbohydrazide (PubChem CID 9472671) has the molecular formula C15H16N2O5S and a molecular weight of 336.37 g/mol. Its IUPAC name is N'-[3-(benzenesulfonyl)propanoyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[3-(benzenesulfonyl)propanoyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9472671 |
| Molecular Formula | C15H16N2O5S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.08 |
| IUPAC Name | N'-[3-(benzenesulfonyl)propanoyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)CCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16N2O5S/c1-11-13(7-9-22-11)15(19)17-16-14(18)8-10-23(20,21)12-5-3-2-4-6-12/h2-7,9H,8,10H2,1H3,(H,16,18)(H,17,19) |
| InChIKey | ZKLWLNHHCYNOPO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|