C10H14N2O3S — CID 34756674
2-methyl-N'-(3-methylsulfanylpropanoyl)furan-3-carbohydrazide (PubChem CID 34756674) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is 2-methyl-N'-(3-methylsulfanylpropanoyl)furan-3-carbohydrazide.
| Compound Name | 2-methyl-N'-(3-methylsulfanylpropanoyl)furan-3-carbohydrazide |
|---|---|
| PubChem CID | 34756674 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 2-methyl-N'-(3-methylsulfanylpropanoyl)furan-3-carbohydrazide |
| SMILES | CSCCC(=O)NNC(=O)c1ccoc1C |
| InChI | InChI=1S/C10H14N2O3S/c1-7-8(3-5-15-7)10(14)12-11-9(13)4-6-16-2/h3,5H,4,6H2,1-2H3,(H,11,13)(H,12,14) |
| InChIKey | ZEUNMGQXEUPHOF-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|