C23H20BrN5O4 — CID 3532118
N-[4-[N-[[5-[(4-bromopyrazol-1-yl)methyl]furan-2-carbonyl]amino]-C-methylcarbonimidoyl]phenyl]-2-methylfuran-3-carboxamide (PubChem CID 3532118) has the molecular formula C23H20BrN5O4 and a molecular weight of 510.35 g/mol. Its IUPAC name is N-[4-[N-[[5-[(4-bromopyrazol-1-yl)methyl]furan-2-carbonyl]amino]-C-methylcarbonimidoyl]phenyl]-2-methylfuran-3-carboxamide.
| Compound Name | N-[4-[N-[[5-[(4-bromopyrazol-1-yl)methyl]furan-2-carbonyl]amino]-C-methylcarbonimidoyl]phenyl]-2-methylfuran-3-carboxamide |
|---|---|
| PubChem CID | 3532118 |
| Molecular Formula | C23H20BrN5O4 |
| Molecular Weight | 510.35 g/mol |
| Exact Mass | 509.07 |
| IUPAC Name | N-[4-[N-[[5-[(4-bromopyrazol-1-yl)methyl]furan-2-carbonyl]amino]-C-methylcarbonimidoyl]phenyl]-2-methylfuran-3-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc(Cn2cc(Br)cn2)o1)c1ccc(NC(=O)c2ccoc2C)cc1 |
| InChI | InChI=1S/C23H20BrN5O4/c1-14(16-3-5-18(6-4-16)26-22(30)20-9-10-32-15(20)2)27-28-23(31)21-8-7-19(33-21)13-29-12-17(24)11-25-29/h3-12H,13H2,1-2H3,(H,26,30)(H,28,31) |
| InChIKey | RQJCGWBQTJRDLP-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.35 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|