C30H25N3O5 — CID 28824211
2-methyl-N-[4-[(Z)-C-methyl-N-[[5-(naphthalen-2-yloxymethyl)furan-2-carbonyl]amino]carbonimidoyl]phenyl]furan-3-carboxamide (PubChem CID 28824211) has the molecular formula C30H25N3O5 and a molecular weight of 507.55 g/mol. Its IUPAC name is 2-methyl-N-[4-[(Z)-C-methyl-N-[[5-(naphthalen-2-yloxymethyl)furan-2-carbonyl]amino]carbonimidoyl]phenyl]furan-3-carboxamide.
| Compound Name | 2-methyl-N-[4-[(Z)-C-methyl-N-[[5-(naphthalen-2-yloxymethyl)furan-2-carbonyl]amino]carbonimidoyl]phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 28824211 |
| Molecular Formula | C30H25N3O5 |
| Molecular Weight | 507.55 g/mol |
| Exact Mass | 507.18 |
| IUPAC Name | 2-methyl-N-[4-[(Z)-C-methyl-N-[[5-(naphthalen-2-yloxymethyl)furan-2-carbonyl]amino]carbonimidoyl]phenyl]furan-3-carboxamide |
| SMILES | C/C(=N/NC(=O)c1ccc(COc2ccc3ccccc3c2)o1)c1ccc(NC(=O)c2ccoc2C)cc1 |
| InChI | InChI=1S/C30H25N3O5/c1-19(21-7-10-24(11-8-21)31-29(34)27-15-16-36-20(27)2)32-33-30(35)28-14-13-26(38-28)18-37-25-12-9-22-5-3-4-6-23(22)17-25/h3-17H,18H2,1-2H3,(H,31,34)(H,33,35)/b32-19- |
| InChIKey | AURAJACRULWBTO-MZFJOGFUSA-N |
| XLogP | 6.32 |
| TPSA | 106.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.55 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|