C21H16N2O3 — CID 717197
5-(naphthalen-2-yloxymethyl)-N-pyridin-3-ylfuran-2-carboxamide (PubChem CID 717197) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is 5-(naphthalen-2-yloxymethyl)-N-pyridin-3-ylfuran-2-carboxamide.
| Compound Name | 5-(naphthalen-2-yloxymethyl)-N-pyridin-3-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 717197 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 5-(naphthalen-2-yloxymethyl)-N-pyridin-3-ylfuran-2-carboxamide |
| SMILES | O=C(Nc1cccnc1)c1ccc(COc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C21H16N2O3/c24-21(23-17-6-3-11-22-13-17)20-10-9-19(26-20)14-25-18-8-7-15-4-1-2-5-16(15)12-18/h1-13H,14H2,(H,23,24) |
| InChIKey | SUMJTXIKMNQJFE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |