C23H17N5O3 — CID 166185177
5-(naphthalen-2-yloxymethyl)-N-[3-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide (PubChem CID 166185177) has the molecular formula C23H17N5O3 and a molecular weight of 411.42 g/mol. Its IUPAC name is 5-(naphthalen-2-yloxymethyl)-N-[3-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide.
| Compound Name | 5-(naphthalen-2-yloxymethyl)-N-[3-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 166185177 |
| Molecular Formula | C23H17N5O3 |
| Molecular Weight | 411.42 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | 5-(naphthalen-2-yloxymethyl)-N-[3-(2H-tetrazol-5-yl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1cccc(-c2nn[nH]n2)c1)c1ccc(COc2ccc3ccccc3c2)o1 |
| InChI | InChI=1S/C23H17N5O3/c29-23(24-18-7-3-6-17(12-18)22-25-27-28-26-22)21-11-10-20(31-21)14-30-19-9-8-15-4-1-2-5-16(15)13-19/h1-13H,14H2,(H,24,29)(H,25,26,27,28) |
| InChIKey | ZKEHWEPKNSFTSN-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 105.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.42 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |