C25H22N6O5 — CID 1020987
N-[1-[4-[(2-methylbenzoyl)amino]phenyl]ethylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide (PubChem CID 1020987) has the molecular formula C25H22N6O5 and a molecular weight of 486.49 g/mol. Its IUPAC name is N-[1-[4-[(2-methylbenzoyl)amino]phenyl]ethylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide.
| Compound Name | N-[1-[4-[(2-methylbenzoyl)amino]phenyl]ethylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 1020987 |
| Molecular Formula | C25H22N6O5 |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | N-[1-[4-[(2-methylbenzoyl)amino]phenyl]ethylideneamino]-5-[(4-nitropyrazol-1-yl)methyl]furan-2-carboxamide |
| SMILES | CC(=NNC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1)c1ccc(NC(=O)c2ccccc2C)cc1 |
| InChI | InChI=1S/C25H22N6O5/c1-16-5-3-4-6-22(16)24(32)27-19-9-7-18(8-10-19)17(2)28-29-25(33)23-12-11-21(36-23)15-30-14-20(13-26-30)31(34)35/h3-14H,15H2,1-2H3,(H,27,32)(H,29,33) |
| InChIKey | WQHWTWGOHWQWHR-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|