C22H24BrN5O3 — CID 5431105
5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]furan-2-carboxamide (PubChem CID 5431105) has the molecular formula C22H24BrN5O3 and a molecular weight of 486.37 g/mol. Its IUPAC name is 5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 5431105 |
| Molecular Formula | C22H24BrN5O3 |
| Molecular Weight | 486.37 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(E)-1-[3-(2,2-dimethylpropanoylamino)phenyl]ethylideneamino]furan-2-carboxamide |
| SMILES | C/C(=N\NC(=O)c1ccc(Cn2cc(Br)cn2)o1)c1cccc(NC(=O)C(C)(C)C)c1 |
| InChI | InChI=1S/C22H24BrN5O3/c1-14(15-6-5-7-17(10-15)25-21(30)22(2,3)4)26-27-20(29)19-9-8-18(31-19)13-28-12-16(23)11-24-28/h5-12H,13H2,1-4H3,(H,25,30)(H,27,29)/b26-14+ |
| InChIKey | XZWMDXUFUGSBCS-VULFUBBASA-N |
| XLogP | 4.43 |
| TPSA | 101.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.37 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|