C16H12BrClN4O3 — CID 1028131
5-[(4-bromopyrazol-1-yl)methyl]-N-[(5-chloro-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide (PubChem CID 1028131) has the molecular formula C16H12BrClN4O3 and a molecular weight of 423.65 g/mol. Its IUPAC name is 5-[(4-bromopyrazol-1-yl)methyl]-N-[(5-chloro-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide.
| Compound Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(5-chloro-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide |
|---|---|
| PubChem CID | 1028131 |
| Molecular Formula | C16H12BrClN4O3 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 421.98 |
| IUPAC Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(5-chloro-2-hydroxyphenyl)methylideneamino]furan-2-carboxamide |
| SMILES | O=C(NN=Cc1cc(Cl)ccc1O)c1ccc(Cn2cc(Br)cn2)o1 |
| InChI | InChI=1S/C16H12BrClN4O3/c17-11-7-20-22(8-11)9-13-2-4-15(25-13)16(24)21-19-6-10-5-12(18)1-3-14(10)23/h1-8,23H,9H2,(H,21,24) |
| InChIKey | FVTCQGOFNNCRTK-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|