C16H13BrClN3O2 — CID 35334159
5-[(4-bromopyrazol-1-yl)methyl]-N-[(2-chlorophenyl)methyl]furan-2-carboxamide (PubChem CID 35334159) has the molecular formula C16H13BrClN3O2 and a molecular weight of 394.66 g/mol. Its IUPAC name is 5-[(4-bromopyrazol-1-yl)methyl]-N-[(2-chlorophenyl)methyl]furan-2-carboxamide.
| Compound Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(2-chlorophenyl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 35334159 |
| Molecular Formula | C16H13BrClN3O2 |
| Molecular Weight | 394.66 g/mol |
| Exact Mass | 392.99 |
| IUPAC Name | 5-[(4-bromopyrazol-1-yl)methyl]-N-[(2-chlorophenyl)methyl]furan-2-carboxamide |
| SMILES | O=C(NCc1ccccc1Cl)c1ccc(Cn2cc(Br)cn2)o1 |
| InChI | InChI=1S/C16H13BrClN3O2/c17-12-8-20-21(9-12)10-13-5-6-15(23-13)16(22)19-7-11-3-1-2-4-14(11)18/h1-6,8-9H,7,10H2,(H,19,22) |
| InChIKey | QXOUMCJTYOVMHL-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 60.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.66 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |