C19H16ClN5O2 — CID 19285356
N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide (PubChem CID 19285356) has the molecular formula C19H16ClN5O2 and a molecular weight of 381.82 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 19285356 |
| Molecular Formula | C19H16ClN5O2 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-5-(pyrazol-1-ylmethyl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccn(Cc2ccccc2Cl)n1)c1ccc(Cn2cccn2)o1 |
| InChI | InChI=1S/C19H16ClN5O2/c20-16-5-2-1-4-14(16)12-25-11-8-18(23-25)22-19(26)17-7-6-15(27-17)13-24-10-3-9-21-24/h1-11H,12-13H2,(H,22,23,26) |
| InChIKey | MVPZGIQPQIPIID-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |