C23H18ClN3O — CID 19285520
N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-phenylbenzamide (PubChem CID 19285520) has the molecular formula C23H18ClN3O and a molecular weight of 387.87 g/mol. Its IUPAC name is N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-phenylbenzamide.
| Compound Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-phenylbenzamide |
|---|---|
| PubChem CID | 19285520 |
| Molecular Formula | C23H18ClN3O |
| Molecular Weight | 387.87 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | N-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-4-phenylbenzamide |
| SMILES | O=C(Nc1ccn(Cc2ccccc2Cl)n1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C23H18ClN3O/c24-21-9-5-4-8-20(21)16-27-15-14-22(26-27)25-23(28)19-12-10-18(11-13-19)17-6-2-1-3-7-17/h1-15H,16H2,(H,25,26,28) |
| InChIKey | WKDHNBFHHDUCHK-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.87 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |