C12H13ClN4S — CID 19395134
1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea (PubChem CID 19395134) has the molecular formula C12H13ClN4S and a molecular weight of 280.78 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 19395134 |
| Molecular Formula | C12H13ClN4S |
| Molecular Weight | 280.78 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1ccn(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H13ClN4S/c1-14-12(18)15-11-6-7-17(16-11)8-9-4-2-3-5-10(9)13/h2-7H,8H2,1H3,(H2,14,15,16,18) |
| InChIKey | XVRVYPGOWZWPHA-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.78 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|