C17H19ClN6S — CID 19333435
1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea (PubChem CID 19333435) has the molecular formula C17H19ClN6S and a molecular weight of 374.90 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea |
|---|---|
| PubChem CID | 19333435 |
| Molecular Formula | C17H19ClN6S |
| Molecular Weight | 374.90 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-[(1,5-dimethylpyrazol-3-yl)methyl]thiourea |
| SMILES | Cc1cc(CNC(=S)Nc2ccn(Cc3ccccc3Cl)n2)nn1C |
| InChI | InChI=1S/C17H19ClN6S/c1-12-9-14(21-23(12)2)10-19-17(25)20-16-7-8-24(22-16)11-13-5-3-4-6-15(13)18/h3-9H,10-11H2,1-2H3,(H2,19,20,22,25) |
| InChIKey | ZSVKYXRUMMCRGI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.90 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|