C16H16BrClN6S — CID 19327034
1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea (PubChem CID 19327034) has the molecular formula C16H16BrClN6S and a molecular weight of 439.77 g/mol. Its IUPAC name is 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea.
| Compound Name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea |
|---|---|
| PubChem CID | 19327034 |
| Molecular Formula | C16H16BrClN6S |
| Molecular Weight | 439.77 g/mol |
| Exact Mass | 438.00 |
| IUPAC Name | 1-[(4-bromo-1-methylpyrazol-5-yl)methyl]-3-[1-[(2-chlorophenyl)methyl]pyrazol-3-yl]thiourea |
| SMILES | Cn1ncc(Br)c1CNC(=S)Nc1ccn(Cc2ccccc2Cl)n1 |
| InChI | InChI=1S/C16H16BrClN6S/c1-23-14(12(17)8-20-23)9-19-16(25)21-15-6-7-24(22-15)10-11-4-2-3-5-13(11)18/h2-8H,9-10H2,1H3,(H2,19,21,22,25) |
| InChIKey | MAAFDIYSMBDSBE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 59.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.77 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|