C12H12Cl2N4S — CID 19397242
1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea (PubChem CID 19397242) has the molecular formula C12H12Cl2N4S and a molecular weight of 315.23 g/mol. Its IUPAC name is 1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea.
| Compound Name | 1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea |
|---|---|
| PubChem CID | 19397242 |
| Molecular Formula | C12H12Cl2N4S |
| Molecular Weight | 315.23 g/mol |
| Exact Mass | 314.02 |
| IUPAC Name | 1-[4-chloro-1-[(2-chlorophenyl)methyl]pyrazol-3-yl]-3-methylthiourea |
| SMILES | CNC(=S)Nc1nn(Cc2ccccc2Cl)cc1Cl |
| InChI | InChI=1S/C12H12Cl2N4S/c1-15-12(19)16-11-10(14)7-18(17-11)6-8-4-2-3-5-9(8)13/h2-5,7H,6H2,1H3,(H2,15,16,17,19) |
| InChIKey | ZOWYZOARQJWIHZ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 41.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.23 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|