C12H7NO7-2 — CID 3347293
5-[[(4-carboxylatofuran-3-carbonyl)amino]methyl]furan-2-carboxylate (PubChem CID 3347293) has the molecular formula C12H7NO7-2 and a molecular weight of 277.19 g/mol. Its IUPAC name is 5-[[(4-carboxylatofuran-3-carbonyl)amino]methyl]furan-2-carboxylate.
| Compound Name | 5-[[(4-carboxylatofuran-3-carbonyl)amino]methyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 3347293 |
| Molecular Formula | C12H7NO7-2 |
| Molecular Weight | 277.19 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 5-[[(4-carboxylatofuran-3-carbonyl)amino]methyl]furan-2-carboxylate |
| SMILES | O=C([O-])c1ccc(CNC(=O)c2cocc2C(=O)[O-])o1 |
| InChI | InChI=1S/C12H9NO7/c14-10(7-4-19-5-8(7)11(15)16)13-3-6-1-2-9(20-6)12(17)18/h1-2,4-5H,3H2,(H,13,14)(H,15,16)(H,17,18)/p-2 |
| InChIKey | YOLQYRVZSNEQMO-UHFFFAOYSA-L |
| XLogP | -1.47 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.19 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |