C13H11NO6 — CID 107728163
5-[[(3,4-dihydroxybenzoyl)amino]methyl]furan-2-carboxylic acid (PubChem CID 107728163) has the molecular formula C13H11NO6 and a molecular weight of 277.23 g/mol. Its IUPAC name is 5-[[(3,4-dihydroxybenzoyl)amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[(3,4-dihydroxybenzoyl)amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 107728163 |
| Molecular Formula | C13H11NO6 |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.06 |
| IUPAC Name | 5-[[(3,4-dihydroxybenzoyl)amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(NCc1ccc(C(=O)O)o1)c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C13H11NO6/c15-9-3-1-7(5-10(9)16)12(17)14-6-8-2-4-11(20-8)13(18)19/h1-5,15-16H,6H2,(H,14,17)(H,18,19) |
| InChIKey | XEHHMOHLGGEPEU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 120.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|