C16H15NO6 — CID 57162604
5-[[[4-(2-carboxyethyl)benzoyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 57162604) has the molecular formula C16H15NO6 and a molecular weight of 317.30 g/mol. Its IUPAC name is 5-[[[4-(2-carboxyethyl)benzoyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[4-(2-carboxyethyl)benzoyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 57162604 |
| Molecular Formula | C16H15NO6 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.09 |
| IUPAC Name | 5-[[[4-(2-carboxyethyl)benzoyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)CCc1ccc(C(=O)NCc2ccc(C(=O)O)o2)cc1 |
| InChI | InChI=1S/C16H15NO6/c18-14(19)8-3-10-1-4-11(5-2-10)15(20)17-9-12-6-7-13(23-12)16(21)22/h1-2,4-7H,3,8-9H2,(H,17,20)(H,18,19)(H,21,22) |
| InChIKey | VDGZIVHKMGNLOH-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 116.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |