C16H14F3NO5 — CID 119246153
5-[[3-[4-(trifluoromethoxy)phenyl]propanoylamino]methyl]furan-2-carboxylic acid (PubChem CID 119246153) has the molecular formula C16H14F3NO5 and a molecular weight of 357.28 g/mol. Its IUPAC name is 5-[[3-[4-(trifluoromethoxy)phenyl]propanoylamino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[3-[4-(trifluoromethoxy)phenyl]propanoylamino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 119246153 |
| Molecular Formula | C16H14F3NO5 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 5-[[3-[4-(trifluoromethoxy)phenyl]propanoylamino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(CCc1ccc(OC(F)(F)F)cc1)NCc1ccc(C(=O)O)o1 |
| InChI | InChI=1S/C16H14F3NO5/c17-16(18,19)25-11-4-1-10(2-5-11)3-8-14(21)20-9-12-6-7-13(24-12)15(22)23/h1-2,4-7H,3,8-9H2,(H,20,21)(H,22,23) |
| InChIKey | AVMFYVCYENYUIB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 88.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |