C16H16F3NO4 — CID 78882053
5-(methoxymethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide (PubChem CID 78882053) has the molecular formula C16H16F3NO4 and a molecular weight of 343.30 g/mol. Its IUPAC name is 5-(methoxymethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide.
| Compound Name | 5-(methoxymethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 78882053 |
| Molecular Formula | C16H16F3NO4 |
| Molecular Weight | 343.30 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | 5-(methoxymethyl)-N-[2-[4-(trifluoromethoxy)phenyl]ethyl]furan-2-carboxamide |
| SMILES | COCc1ccc(C(=O)NCCc2ccc(OC(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C16H16F3NO4/c1-22-10-13-6-7-14(23-13)15(21)20-9-8-11-2-4-12(5-3-11)24-16(17,18)19/h2-7H,8-10H2,1H3,(H,20,21) |
| InChIKey | UCVKRGNLEULXML-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |