C13H10F3NO4 — CID 63316722
5-[[2-(trifluoromethoxy)anilino]methyl]furan-2-carboxylic acid (PubChem CID 63316722) has the molecular formula C13H10F3NO4 and a molecular weight of 301.22 g/mol. Its IUPAC name is 5-[[2-(trifluoromethoxy)anilino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[2-(trifluoromethoxy)anilino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 63316722 |
| Molecular Formula | C13H10F3NO4 |
| Molecular Weight | 301.22 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 5-[[2-(trifluoromethoxy)anilino]methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CNc2ccccc2OC(F)(F)F)o1 |
| InChI | InChI=1S/C13H10F3NO4/c14-13(15,16)21-10-4-2-1-3-9(10)17-7-8-5-6-11(20-8)12(18)19/h1-6,17H,7H2,(H,18,19) |
| InChIKey | JWASYKMSRVSMMP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.22 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |