C13H12ClNO3 — CID 114250964
5-[(2-chloro-3-methylanilino)methyl]furan-2-carboxylic acid (PubChem CID 114250964) has the molecular formula C13H12ClNO3 and a molecular weight of 265.70 g/mol. Its IUPAC name is 5-[(2-chloro-3-methylanilino)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-chloro-3-methylanilino)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 114250964 |
| Molecular Formula | C13H12ClNO3 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | 5-[(2-chloro-3-methylanilino)methyl]furan-2-carboxylic acid |
| SMILES | Cc1cccc(NCc2ccc(C(=O)O)o2)c1Cl |
| InChI | InChI=1S/C13H12ClNO3/c1-8-3-2-4-10(12(8)14)15-7-9-5-6-11(18-9)13(16)17/h2-6,15H,7H2,1H3,(H,16,17) |
| InChIKey | HNSGDPRQZNULJA-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |