C16H21N3O4 — CID 120527267
5-[[[5-ethyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 120527267) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 5-[[[5-ethyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[5-ethyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 120527267 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 5-[[[5-ethyl-1-(2-methylpropyl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | CCc1c(C(=O)NCc2ccc(C(=O)O)o2)cnn1CC(C)C |
| InChI | InChI=1S/C16H21N3O4/c1-4-13-12(8-18-19(13)9-10(2)3)15(20)17-7-11-5-6-14(23-11)16(21)22/h5-6,8,10H,4,7,9H2,1-3H3,(H,17,20)(H,21,22) |
| InChIKey | VATDPQGWSZXXQH-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |