C18H24FN3O2 — CID 109478350
5-ethyl-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)pyrazole-4-carboxamide (PubChem CID 109478350) has the molecular formula C18H24FN3O2 and a molecular weight of 333.41 g/mol. Its IUPAC name is 5-ethyl-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)pyrazole-4-carboxamide.
| Compound Name | 5-ethyl-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 109478350 |
| Molecular Formula | C18H24FN3O2 |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 5-ethyl-N-[2-(2-fluorophenyl)-2-hydroxyethyl]-1-(2-methylpropyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCC(O)c2ccccc2F)cnn1CC(C)C |
| InChI | InChI=1S/C18H24FN3O2/c1-4-16-14(9-21-22(16)11-12(2)3)18(24)20-10-17(23)13-7-5-6-8-15(13)19/h5-9,12,17,23H,4,10-11H2,1-3H3,(H,20,24) |
| InChIKey | JCCBCRRIUBJYPD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |