C16H19N3O5 — CID 120527209
5-[[[5-methyl-1-(oxan-4-yl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid (PubChem CID 120527209) has the molecular formula C16H19N3O5 and a molecular weight of 333.34 g/mol. Its IUPAC name is 5-[[[5-methyl-1-(oxan-4-yl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid.
| Compound Name | 5-[[[5-methyl-1-(oxan-4-yl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 120527209 |
| Molecular Formula | C16H19N3O5 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.13 |
| IUPAC Name | 5-[[[5-methyl-1-(oxan-4-yl)pyrazole-4-carbonyl]amino]methyl]furan-2-carboxylic acid |
| SMILES | Cc1c(C(=O)NCc2ccc(C(=O)O)o2)cnn1C1CCOCC1 |
| InChI | InChI=1S/C16H19N3O5/c1-10-13(9-18-19(10)11-4-6-23-7-5-11)15(20)17-8-12-2-3-14(24-12)16(21)22/h2-3,9,11H,4-8H2,1H3,(H,17,20)(H,21,22) |
| InChIKey | VKFLFCUGAXADIF-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 106.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |