About 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide
4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide (PubChem CID 3388381) has the molecular formula C15H12N4O6
and a molecular weight of 344.28 g/mol. Its IUPAC name is 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide.
Molecular Properties
| Compound Name | 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide |
| PubChem CID | 3388381 |
| Molecular Formula | C15H12N4O6 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide |
| SMILES | O=C(Cc1ccccc1[N+](=O)[O-])NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H12N4O6/c20-14(9-11-3-1-2-4-13(11)19(24)25)16-17-15(21)10-5-7-12(8-6-10)18(22)23/h1-8H,9H2,(H,16,20)(H,17,21) |
| InChIKey | OSFFPXSCVMCCPK-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 144.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide?
The IUPAC name of 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide (CID 3388381) is 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide.
What is the SMILES notation for 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide?
The canonical SMILES for 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide is O=C(Cc1ccccc1[N+](=O)[O-])NNC(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide?
The InChIKey is OSFFPXSCVMCCPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N4O6/c20-14(9-11-3-1-2-4-13(11)19(24)25)16-17-15(21)10-5-7-12(8-6-10)18(22)23/h1-8H,9H2,(H,16,20)(H,17,21).
What are the key properties of 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide?
4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide has a molecular weight of 344.28 g/mol, XLogP of 1.51, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-N'-[2-(2-nitrophenyl)acetyl]benzohydrazide is sourced from PubChem (CID 3388381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).