C15H15N3O5 — CID 4808584
2,5-dimethyl-N'-[2-(2-nitrophenyl)acetyl]furan-3-carbohydrazide (PubChem CID 4808584) has the molecular formula C15H15N3O5 and a molecular weight of 317.30 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[2-(2-nitrophenyl)acetyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[2-(2-nitrophenyl)acetyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 4808584 |
| Molecular Formula | C15H15N3O5 |
| Molecular Weight | 317.30 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 2,5-dimethyl-N'-[2-(2-nitrophenyl)acetyl]furan-3-carbohydrazide |
| SMILES | Cc1cc(C(=O)NNC(=O)Cc2ccccc2[N+](=O)[O-])c(C)o1 |
| InChI | InChI=1S/C15H15N3O5/c1-9-7-12(10(2)23-9)15(20)17-16-14(19)8-11-5-3-4-6-13(11)18(21)22/h3-7H,8H2,1-2H3,(H,16,19)(H,17,20) |
| InChIKey | JZIIBAGTMULOAE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 114.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.30 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|