C18H22N2O6 — CID 9084950
2,5-dimethyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]furan-3-carbohydrazide (PubChem CID 9084950) has the molecular formula C18H22N2O6 and a molecular weight of 362.38 g/mol. Its IUPAC name is 2,5-dimethyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]furan-3-carbohydrazide.
| Compound Name | 2,5-dimethyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]furan-3-carbohydrazide |
|---|---|
| PubChem CID | 9084950 |
| Molecular Formula | C18H22N2O6 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2,5-dimethyl-N'-[2-(2,3,4-trimethoxyphenyl)acetyl]furan-3-carbohydrazide |
| SMILES | COc1ccc(CC(=O)NNC(=O)c2cc(C)oc2C)c(OC)c1OC |
| InChI | InChI=1S/C18H22N2O6/c1-10-8-13(11(2)26-10)18(22)20-19-15(21)9-12-6-7-14(23-3)17(25-5)16(12)24-4/h6-8H,9H2,1-5H3,(H,19,21)(H,20,22) |
| InChIKey | WNVYOQTYQGBKGV-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|